| Name | 2,4-Bis(dodecylthiomethyl)-6-methylphenol |
| Synonyms | At 1726 Irganox 1726 Antioxidant 1726 Antioxidant RC 1726 4,6-bis (dodecylthiomethyl)-o-cresol 2,4-BIS(DODECYLTHIOMETHYL)-6-METHYLPHENOL 2,4-Bis(dodecylthiomethyl)-6-methylphenol 2,4-BIS(DODECYLTHIOMETHYL)-6-METHLYPHENOL 2,4-Bis(dodecylsulfanylmethyl)-6-methylphenol Phenol, 2,4-bis[(dodecylthio)methyl]-6-methyl- 2,4-bis[(dodecylsulfanyl)methyl]-6-methylphenol |
| CAS | 110675-26-8 |
| EINECS | 1533716-785-6 |
| InChI | InChI=1/C33H60OS2/c1-4-6-8-10-12-14-16-18-20-22-24-35-28-31-26-30(3)33(34)32(27-31)29-36-25-23-21-19-17-15-13-11-9-7-5-2/h26-27,34H,4-25,28-29H2,1-3H3 |
| Molecular Formula | C33H60OS2 |
| Molar Mass | 536.96 |
| Density | 0.957 |
| Melting Point | 30 °C |
| Boling Point | 620.8±50.0 °C(Predicted) |
| Flash Point | 300.5°C |
| Vapor Presure | 5.24E-16mmHg at 25°C |
| pKa | 9.94±0.50(Predicted) |
| Storage Condition | Room Temprature |
| Refractive Index | 1.518 |
| introduction | antioxidant 1726 is white or light yellow solid, with a relative molecular weight of 536.96, a melting point of 28 ℃, soluble in various organic solvents and insoluble in water. Flash point: 232 ℃. |
| properties | antioxidant 1726 can provide thermal stability and processing stability for polymers at the same time because its molecule contains both a main antioxidant and an auxiliary antioxidant structure. If necessary, it can also be used in combination with main antioxidants, auxiliary antioxidants and light stabilizers. |
| application | antioxidant 1726 is a multifunctional hindered phenolic antioxidant, which can be applied to a variety of polymers. it is especially recommended for adhesives, such as hot melt adhesive (HMA) based on SBS or SIS, solvent based adhesive (SBA) based on natural rubber, neoprene, etc. and water based adhesive (WBA). |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |